C19H18FN5O2S — CID 25362490
(2R)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-1-morpholin-4-yl-2-phenylethanone (PubChem CID 25362490) has the molecular formula C19H18FN5O2S and a molecular weight of 399.45 g/mol. Its IUPAC name is (2R)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-1-morpholin-4-yl-2-phenylethanone.
| Compound Name | (2R)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-1-morpholin-4-yl-2-phenylethanone |
|---|---|
| PubChem CID | 25362490 |
| Molecular Formula | C19H18FN5O2S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (2R)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-1-morpholin-4-yl-2-phenylethanone |
| SMILES | O=C([C@H](Sc1nnnn1-c1cccc(F)c1)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C19H18FN5O2S/c20-15-7-4-8-16(13-15)25-19(21-22-23-25)28-17(14-5-2-1-3-6-14)18(26)24-9-11-27-12-10-24/h1-8,13,17H,9-12H2/t17-/m1/s1 |
| InChIKey | JIAIGNBIBRXVDI-QGZVFWFLSA-N |
| XLogP | 2.49 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |