C15H21NOS — CID 28771690
(2S)-1-(azepan-1-yl)-2-phenylsulfanylpropan-1-one (PubChem CID 28771690) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is (2S)-1-(azepan-1-yl)-2-phenylsulfanylpropan-1-one.
| Compound Name | (2S)-1-(azepan-1-yl)-2-phenylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 28771690 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2S)-1-(azepan-1-yl)-2-phenylsulfanylpropan-1-one |
| SMILES | C[C@H](Sc1ccccc1)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C15H21NOS/c1-13(18-14-9-5-4-6-10-14)15(17)16-11-7-2-3-8-12-16/h4-6,9-10,13H,2-3,7-8,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | GTQIHWNZANVHLI-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |