C15H21NOS — CID 39074926
(2R)-2-(4-methylphenyl)sulfanyl-1-piperidin-1-ylpropan-1-one (PubChem CID 39074926) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is (2R)-2-(4-methylphenyl)sulfanyl-1-piperidin-1-ylpropan-1-one.
| Compound Name | (2R)-2-(4-methylphenyl)sulfanyl-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 39074926 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2R)-2-(4-methylphenyl)sulfanyl-1-piperidin-1-ylpropan-1-one |
| SMILES | Cc1ccc(S[C@H](C)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C15H21NOS/c1-12-6-8-14(9-7-12)18-13(2)15(17)16-10-4-3-5-11-16/h6-9,13H,3-5,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | JZYJFCGZBNJLGJ-CYBMUJFWSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |