C16H21NO3S — CID 64929530
2-[4-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylphenyl]acetic acid (PubChem CID 64929530) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[4-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylphenyl]acetic acid.
| Compound Name | 2-[4-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 64929530 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[4-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylphenyl]acetic acid |
| SMILES | CC(Sc1ccc(CC(=O)O)cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H21NO3S/c1-12(16(20)17-9-3-2-4-10-17)21-14-7-5-13(6-8-14)11-15(18)19/h5-8,12H,2-4,9-11H2,1H3,(H,18,19) |
| InChIKey | MOGQPXLOLXMOEA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |