C13H18N2OS — CID 125142459
(2R)-1-piperidin-1-yl-2-pyridin-4-ylsulfanylpropan-1-one (PubChem CID 125142459) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is (2R)-1-piperidin-1-yl-2-pyridin-4-ylsulfanylpropan-1-one.
| Compound Name | (2R)-1-piperidin-1-yl-2-pyridin-4-ylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 125142459 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R)-1-piperidin-1-yl-2-pyridin-4-ylsulfanylpropan-1-one |
| SMILES | C[C@@H](Sc1ccncc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H18N2OS/c1-11(17-12-5-7-14-8-6-12)13(16)15-9-3-2-4-10-15/h5-8,11H,2-4,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | UZWZMEZPVJIBDR-LLVKDONJSA-N |
| XLogP | 2.57 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |