C18H22N4OS — CID 9427598
(2R)-2-(4-methylphenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 9427598) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is (2R)-2-(4-methylphenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | (2R)-2-(4-methylphenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 9427598 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2R)-2-(4-methylphenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | Cc1ccc(S[C@H](C)C(=O)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C18H22N4OS/c1-14-4-6-16(7-5-14)24-15(2)17(23)21-10-12-22(13-11-21)18-19-8-3-9-20-18/h3-9,15H,10-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | IRXUZTYIUBHZCD-OAHLLOKOSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |