C24H29N5O4 — CID 55787857
N-[1-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 55787857) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[1-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55787857 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N-[1-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | CC(C)CC(C(=O)N1CCC(NC(=O)c2cnn(C)c2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H29N5O4/c1-15(2)12-20(29-22(31)18-6-4-5-7-19(18)23(29)32)24(33)28-10-8-17(9-11-28)26-21(30)16-13-25-27(3)14-16/h4-7,13-15,17,20H,8-12H2,1-3H3,(H,26,30) |
| InChIKey | PVTXLBXDIHXINB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|