C25H28N4O2S — CID 47043552
N-[1-(2-benzhydrylsulfanylacetyl)piperidin-4-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 47043552) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[1-(2-benzhydrylsulfanylacetyl)piperidin-4-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-(2-benzhydrylsulfanylacetyl)piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47043552 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[1-(2-benzhydrylsulfanylacetyl)piperidin-4-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC2CCN(C(=O)CSC(c3ccccc3)c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C25H28N4O2S/c1-28-17-21(16-26-28)25(31)27-22-12-14-29(15-13-22)23(30)18-32-24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,16-17,22,24H,12-15,18H2,1H3,(H,27,31) |
| InChIKey | UPEVWWFBOLSSAN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |