C15H26N4O3S — CID 154748608
1-methyl-N-[1-(2-methylbutylsulfonyl)piperidin-4-yl]pyrazole-4-carboxamide (PubChem CID 154748608) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is 1-methyl-N-[1-(2-methylbutylsulfonyl)piperidin-4-yl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[1-(2-methylbutylsulfonyl)piperidin-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 154748608 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-methyl-N-[1-(2-methylbutylsulfonyl)piperidin-4-yl]pyrazole-4-carboxamide |
| SMILES | CCC(C)CS(=O)(=O)N1CCC(NC(=O)c2cnn(C)c2)CC1 |
| InChI | InChI=1S/C15H26N4O3S/c1-4-12(2)11-23(21,22)19-7-5-14(6-8-19)17-15(20)13-9-16-18(3)10-13/h9-10,12,14H,4-8,11H2,1-3H3,(H,17,20) |
| InChIKey | VHHDFUXNAVELMX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |