C12H18N4O3S — CID 127667132
N-(1-ethylsulfonylpiperidin-4-yl)pyridazine-4-carboxamide (PubChem CID 127667132) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(1-ethylsulfonylpiperidin-4-yl)pyridazine-4-carboxamide.
| Compound Name | N-(1-ethylsulfonylpiperidin-4-yl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 127667132 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(1-ethylsulfonylpiperidin-4-yl)pyridazine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(NC(=O)c2ccnnc2)CC1 |
| InChI | InChI=1S/C12H18N4O3S/c1-2-20(18,19)16-7-4-11(5-8-16)15-12(17)10-3-6-13-14-9-10/h3,6,9,11H,2,4-5,7-8H2,1H3,(H,15,17) |
| InChIKey | DJCAABLGFDZNPE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |