C22H36N2O4S — CID 112812290
3,5-ditert-butyl-N-(1-ethylsulfonylpiperidin-4-yl)-4-hydroxybenzamide (PubChem CID 112812290) has the molecular formula C22H36N2O4S and a molecular weight of 424.61 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-(1-ethylsulfonylpiperidin-4-yl)-4-hydroxybenzamide.
| Compound Name | 3,5-ditert-butyl-N-(1-ethylsulfonylpiperidin-4-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 112812290 |
| Molecular Formula | C22H36N2O4S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 3,5-ditert-butyl-N-(1-ethylsulfonylpiperidin-4-yl)-4-hydroxybenzamide |
| SMILES | CCS(=O)(=O)N1CCC(NC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C22H36N2O4S/c1-8-29(27,28)24-11-9-16(10-12-24)23-20(26)15-13-17(21(2,3)4)19(25)18(14-15)22(5,6)7/h13-14,16,25H,8-12H2,1-7H3,(H,23,26) |
| InChIKey | SFWTZRQOFPVKHC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |