C20H24N2O5S — CID 108562882
N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-3,5-dihydroxybenzamide (PubChem CID 108562882) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-3,5-dihydroxybenzamide.
| Compound Name | N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108562882 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-3,5-dihydroxybenzamide |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(NC(=O)c3cc(O)cc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-2-14-3-5-19(6-4-14)28(26,27)22-9-7-16(8-10-22)21-20(25)15-11-17(23)13-18(24)12-15/h3-6,11-13,16,23-24H,2,7-10H2,1H3,(H,21,25) |
| InChIKey | SGBMABCHYBAVGQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |