C21H20F6N2O3S — CID 24609608
N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 24609608) has the molecular formula C21H20F6N2O3S and a molecular weight of 494.46 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 24609608 |
| Molecular Formula | C21H20F6N2O3S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H20F6N2O3S/c1-13-2-4-18(5-3-13)33(31,32)29-8-6-17(7-9-29)28-19(30)14-10-15(20(22,23)24)12-16(11-14)21(25,26)27/h2-5,10-12,17H,6-9H2,1H3,(H,28,30) |
| InChIKey | DPLVRURRNSPAGW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |