C23H30N2O3S — CID 108561824
N-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-3-methylbenzamide (PubChem CID 108561824) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-3-methylbenzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 108561824 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C23H30N2O3S/c1-17-6-5-7-18(16-17)22(26)24-20-12-14-25(15-13-20)29(27,28)21-10-8-19(9-11-21)23(2,3)4/h5-11,16,20H,12-15H2,1-4H3,(H,24,26) |
| InChIKey | VTTAEQRWZPFXLI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |