C12H17N5OS — CID 104670473
N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]pyridazine-4-carboxamide (PubChem CID 104670473) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]pyridazine-4-carboxamide.
| Compound Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104670473 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]pyridazine-4-carboxamide |
| SMILES | NC(=S)CN1CCC(NC(=O)c2ccnnc2)CC1 |
| InChI | InChI=1S/C12H17N5OS/c13-11(19)8-17-5-2-10(3-6-17)16-12(18)9-1-4-14-15-7-9/h1,4,7,10H,2-3,5-6,8H2,(H2,13,19)(H,16,18) |
| InChIKey | ZTLAMBHNPLTBNE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|