C14H18IN3OS — CID 63627321
N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-iodobenzamide (PubChem CID 63627321) has the molecular formula C14H18IN3OS and a molecular weight of 403.29 g/mol. Its IUPAC name is N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-iodobenzamide.
| Compound Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-iodobenzamide |
|---|---|
| PubChem CID | 63627321 |
| Molecular Formula | C14H18IN3OS |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-4-iodobenzamide |
| SMILES | NC(=S)CN1CCC(NC(=O)c2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C14H18IN3OS/c15-11-3-1-10(2-4-11)14(19)17-12-5-7-18(8-6-12)9-13(16)20/h1-4,12H,5-9H2,(H2,16,20)(H,17,19) |
| InChIKey | PUXBHBCPFPKHPM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|