C20H18N4O3 — CID 4827047
2-[1-(benzotriazol-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione (PubChem CID 4827047) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[1-(benzotriazol-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(benzotriazol-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4827047 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[1-(benzotriazol-1-yl)-4-methyl-1-oxopentan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)CC(C(=O)n1nnc2ccccc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18N4O3/c1-12(2)11-17(20(27)24-16-10-6-5-9-15(16)21-22-24)23-18(25)13-7-3-4-8-14(13)19(23)26/h3-10,12,17H,11H2,1-2H3 |
| InChIKey | CRRRDHXYDOKYIC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|