C18H24N2O3 — CID 112762971
2-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4-methylpentanamide (PubChem CID 112762971) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4-methylpentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4-methylpentanamide |
|---|---|
| PubChem CID | 112762971 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4-methylpentanamide |
| SMILES | CCN(CC)C(=O)C(CC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H24N2O3/c1-5-19(6-2)18(23)15(11-12(3)4)20-16(21)13-9-7-8-10-14(13)17(20)22/h7-10,12,15H,5-6,11H2,1-4H3 |
| InChIKey | CKVNQYHYEJUBHY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|