C23H23N3O3S — CID 16559919
N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methylpentanamide (PubChem CID 16559919) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methylpentanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methylpentanamide |
|---|---|
| PubChem CID | 16559919 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-ethyl-4-methylpentanamide |
| SMILES | CCN(C(=O)C(CC(C)C)N1C(=O)c2ccccc2C1=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H23N3O3S/c1-4-25(23-24-17-11-7-8-12-19(17)30-23)22(29)18(13-14(2)3)26-20(27)15-9-5-6-10-16(15)21(26)28/h5-12,14,18H,4,13H2,1-3H3 |
| InChIKey | PMSMUTTWUFSDMI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|