C24H19N3O2S — CID 16605874
N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 16605874) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 16605874 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CCN(C(=O)Cn1c2ccccc2c(=O)c2ccccc21)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H19N3O2S/c1-2-26(24-25-18-11-5-8-14-21(18)30-24)22(28)15-27-19-12-6-3-9-16(19)23(29)17-10-4-7-13-20(17)27/h3-14H,2,15H2,1H3 |
| InChIKey | JUSLQBLBMZNYRJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|