C25H21N3O2S — CID 30135418
N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 30135418) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 30135418 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | C[C@H](c1nc2ccccc2s1)N(C)C(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C25H21N3O2S/c1-16(25-26-19-11-5-8-14-22(19)31-25)27(2)23(29)15-28-20-12-6-3-9-17(20)24(30)18-10-4-7-13-21(18)28/h3-14,16H,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | SAFUDDPKDOOQRG-MRXNPFEDSA-N |
| XLogP | 4.98 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|