C27H24N4O3S — CID 41184016
N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide (PubChem CID 41184016) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide.
| Compound Name | N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 41184016 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide |
| SMILES | C[C@H](c1nc2ccccc2s1)N(C)C(=O)CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H24N4O3S/c1-18(24-28-21-15-9-10-16-22(21)35-24)30(2)23(32)17-31-25(33)27(29-26(31)34,19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,18H,17H2,1-2H3,(H,29,34)/t18-/m1/s1 |
| InChIKey | FAIQOLCGLMJKDA-GOSISDBHSA-N |
| XLogP | 4.31 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|