C14H13N5O3S — CID 47045997
N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 47045997) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 47045997 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | CCN(C(=O)Cn1ccc([N+](=O)[O-])n1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H13N5O3S/c1-2-18(14-15-10-5-3-4-6-11(10)23-14)13(20)9-17-8-7-12(16-17)19(21)22/h3-8H,2,9H2,1H3 |
| InChIKey | ODSUIUIKJSVSNZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|