C18H16N4O5S — CID 166435373
[2-[1,3-benzothiazol-2-yl(ethyl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate (PubChem CID 166435373) has the molecular formula C18H16N4O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is [2-[1,3-benzothiazol-2-yl(ethyl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate.
| Compound Name | [2-[1,3-benzothiazol-2-yl(ethyl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
|---|---|
| PubChem CID | 166435373 |
| Molecular Formula | C18H16N4O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [2-[1,3-benzothiazol-2-yl(ethyl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
| SMILES | CCN(C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H16N4O5S/c1-2-21(18-20-14-5-3-4-6-15(14)28-18)16(23)10-27-17(24)12-9-11(22(25)26)7-8-13(12)19/h3-9H,2,10,19H2,1H3 |
| InChIKey | HHJBJTOTDGKELG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|