C18H16N4O5 — CID 35987154
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-amino-5-nitrobenzoate (PubChem CID 35987154) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-amino-5-nitrobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
|---|---|
| PubChem CID | 35987154 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N)c1ccccc1 |
| InChI | InChI=1S/C18H16N4O5/c19-9-4-10-21(13-5-2-1-3-6-13)17(23)12-27-18(24)15-11-14(22(25)26)7-8-16(15)20/h1-3,5-8,11H,4,10,12,20H2 |
| InChIKey | RFIHTWNCJSRNRK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|