C18H15N3O5 — CID 2351836
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-nitrobenzoate (PubChem CID 2351836) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 2351836 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-nitrobenzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O5/c19-10-5-11-20(15-7-2-1-3-8-15)17(22)13-26-18(23)14-6-4-9-16(12-14)21(24)25/h1-4,6-9,12H,5,11,13H2 |
| InChIKey | FYNMVVIOZSYLPT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|