C22H24N2O5 — CID 2353432
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 2353432) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 2353432 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N(CCC#N)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C22H24N2O5/c1-3-27-19-12-11-17(15-20(19)28-4-2)22(26)29-16-21(25)24(14-8-13-23)18-9-6-5-7-10-18/h5-7,9-12,15H,3-4,8,14,16H2,1-2H3 |
| InChIKey | BAFJBFWKFYBHRY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |