C20H19IN2O4 — CID 16522262
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 3-iodobenzoate (PubChem CID 16522262) has the molecular formula C20H19IN2O4 and a molecular weight of 478.29 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 3-iodobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 3-iodobenzoate |
|---|---|
| PubChem CID | 16522262 |
| Molecular Formula | C20H19IN2O4 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 3-iodobenzoate |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)COC(=O)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C20H19IN2O4/c1-2-26-18-9-7-17(8-10-18)23(12-4-11-22)19(24)14-27-20(25)15-5-3-6-16(21)13-15/h3,5-10,13H,2,4,12,14H2,1H3 |
| InChIKey | XYPPMIVCBVMTML-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|