C22H24N2O5 — CID 30801137
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(methoxymethyl)benzoate (PubChem CID 30801137) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(methoxymethyl)benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 30801137 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(methoxymethyl)benzoate |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)COC(=O)c2ccc(COC)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-3-28-20-11-9-19(10-12-20)24(14-4-13-23)21(25)16-29-22(26)18-7-5-17(6-8-18)15-27-2/h5-12H,3-4,14-16H2,1-2H3 |
| InChIKey | KTZCWGKOYCRMPC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |