C19H18N2O4 — CID 51172550
methyl 4-[2-[N-(2-cyanoethyl)anilino]-2-oxoethoxy]benzoate (PubChem CID 51172550) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl 4-[2-[N-(2-cyanoethyl)anilino]-2-oxoethoxy]benzoate.
| Compound Name | methyl 4-[2-[N-(2-cyanoethyl)anilino]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 51172550 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | methyl 4-[2-[N-(2-cyanoethyl)anilino]-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)N(CCC#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N2O4/c1-24-19(23)15-8-10-17(11-9-15)25-14-18(22)21(13-5-12-20)16-6-3-2-4-7-16/h2-4,6-11H,5,13-14H2,1H3 |
| InChIKey | MKBXXXJKGSLGRL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |