C23H26N2O4 — CID 7194186
[2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate (PubChem CID 7194186) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 7194186 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate |
| SMILES | Cc1ccc(N(CCC#N)C(=O)COC(=O)c2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-17(2)15-28-21-11-7-19(8-12-21)23(27)29-16-22(26)25(14-4-13-24)20-9-5-18(3)6-10-20/h5-12,17H,4,14-16H2,1-3H3 |
| InChIKey | RGLZUVQZQFYADA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |