C20H17N3O3 — CID 2627241
[2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-cyanobenzoate (PubChem CID 2627241) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 2627241 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-cyanobenzoate |
| SMILES | Cc1ccc(N(CCC#N)C(=O)COC(=O)c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C20H17N3O3/c1-15-6-8-18(9-7-15)23(11-3-10-21)19(24)14-26-20(25)17-5-2-4-16(12-17)13-22/h2,4-9,12H,3,11,14H2,1H3 |
| InChIKey | IVYHSGWPRVXBLN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |