About [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate
[2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate (PubChem CID 18127905) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate.
Molecular Properties
| Compound Name | [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate |
| PubChem CID | 18127905 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate |
| SMILES | CCN(C(=O)COC(=O)c1cccc(C#N)c1)c1ccccc1C |
| InChI | InChI=1S/C19H18N2O3/c1-3-21(17-10-5-4-7-14(17)2)18(22)13-24-19(23)16-9-6-8-15(11-16)12-20/h4-11H,3,13H2,1-2H3 |
| InChIKey | WCYOCMVKDVITPR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate?
The IUPAC name of [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate (CID 18127905) is [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate.
What is the SMILES notation for [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate?
The canonical SMILES for [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate is CCN(C(=O)COC(=O)c1cccc(C#N)c1)c1ccccc1C.
What is the InChIKey of [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate?
The InChIKey is WCYOCMVKDVITPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-3-21(17-10-5-4-7-14(17)2)18(22)13-24-19(23)16-9-6-8-15(11-16)12-20/h4-11H,3,13H2,1-2H3.
What are the key properties of [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate?
[2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate has a molecular weight of 322.36 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 3-cyanobenzoate is sourced from PubChem (CID 18127905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).