C20H22N2O5 — CID 18128442
[2-(N-ethyl-2-methylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate (PubChem CID 18128442) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 18128442 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [2-(N-ethyl-2-methylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
| SMILES | CCN(C(=O)COC(=O)c1ccc(OCC(N)=O)cc1)c1ccccc1C |
| InChI | InChI=1S/C20H22N2O5/c1-3-22(17-7-5-4-6-14(17)2)19(24)13-27-20(25)15-8-10-16(11-9-15)26-12-18(21)23/h4-11H,3,12-13H2,1-2H3,(H2,21,23) |
| InChIKey | OMDKRFOTMMBBAQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |