C16H14N2O3S — CID 18080870
[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-cyanobenzoate (PubChem CID 18080870) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 18080870 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-cyanobenzoate |
| SMILES | CN(Cc1cccs1)C(=O)COC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H14N2O3S/c1-18(10-14-6-3-7-22-14)15(19)11-21-16(20)13-5-2-4-12(8-13)9-17/h2-8H,10-11H2,1H3 |
| InChIKey | LAAIHKKVBNEZBX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |