C16H14F3NO3S2 — CID 55424840
[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 4-(trifluoromethylsulfanyl)benzoate (PubChem CID 55424840) has the molecular formula C16H14F3NO3S2 and a molecular weight of 389.42 g/mol. Its IUPAC name is [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 4-(trifluoromethylsulfanyl)benzoate.
| Compound Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 4-(trifluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55424840 |
| Molecular Formula | C16H14F3NO3S2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 4-(trifluoromethylsulfanyl)benzoate |
| SMILES | CN(Cc1cccs1)C(=O)COC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NO3S2/c1-20(9-13-3-2-8-24-13)14(21)10-23-15(22)11-4-6-12(7-5-11)25-16(17,18)19/h2-8H,9-10H2,1H3 |
| InChIKey | DMSRYABVUUJQHY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |