C22H22N2O5S2 — CID 42003252
[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 42003252) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 42003252 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(Cc1cccs1)C(=O)COC(=O)c1cccc(S(=O)(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2O5S2/c1-23(15-19-11-7-13-30-19)21(25)16-29-22(26)17-8-6-12-20(14-17)31(27,28)24(2)18-9-4-3-5-10-18/h3-14H,15-16H2,1-2H3 |
| InChIKey | YLACBJNFTYURTB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |