C14H13BrN2O3S — CID 30650726
[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 5-bromopyridine-3-carboxylate (PubChem CID 30650726) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 5-bromopyridine-3-carboxylate.
| Compound Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 5-bromopyridine-3-carboxylate |
|---|---|
| PubChem CID | 30650726 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 5-bromopyridine-3-carboxylate |
| SMILES | CN(Cc1cccs1)C(=O)COC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C14H13BrN2O3S/c1-17(8-12-3-2-4-21-12)13(18)9-20-14(19)10-5-11(15)7-16-6-10/h2-7H,8-9H2,1H3 |
| InChIKey | WDAVDIPFMGOVLG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |