C23H26N4O4 — CID 56514981
N'-(2-cyanoethyl)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-N'-phenylbutanediamide (PubChem CID 56514981) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56514981 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-N'-phenylbutanediamide |
| SMILES | CN(C)C(=O)COc1ccc(NC(=O)CCC(=O)N(CCC#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-26(2)23(30)17-31-20-11-9-18(10-12-20)25-21(28)13-14-22(29)27(16-6-15-24)19-7-4-3-5-8-19/h3-5,7-12H,6,13-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | VBXHMRWFNGTADB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |