C21H25N4O3+ — CID 9222823
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 9222823) has the molecular formula C21H25N4O3+ and a molecular weight of 381.46 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9222823 |
| Molecular Formula | C21H25N4O3+ |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(NC(=O)C[NH+](C)CC(=O)N(CCC#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-24(15-20(26)23-17-9-11-19(28-2)12-10-17)16-21(27)25(14-6-13-22)18-7-4-3-5-8-18/h3-5,7-12H,6,14-16H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | PMFYQBQVXAFURU-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |