C18H21FN3O3+ — CID 2658345
[2-(2-fluoroanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 2658345) has the molecular formula C18H21FN3O3+ and a molecular weight of 346.38 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 2658345 |
| Molecular Formula | C18H21FN3O3+ |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H20FN3O3/c1-22(12-18(24)21-16-6-4-3-5-15(16)19)11-17(23)20-13-7-9-14(25-2)10-8-13/h3-10H,11-12H2,1-2H3,(H,20,23)(H,21,24)/p+1 |
| InChIKey | XVGMXXGGTMTVHT-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |