C17H16FN3O4 — CID 17433816
N-[2-(2-fluoroanilino)-2-oxoethyl]-N'-(4-methoxyphenyl)oxamide (PubChem CID 17433816) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-[2-(2-fluoroanilino)-2-oxoethyl]-N'-(4-methoxyphenyl)oxamide.
| Compound Name | N-[2-(2-fluoroanilino)-2-oxoethyl]-N'-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 17433816 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[2-(2-fluoroanilino)-2-oxoethyl]-N'-(4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCC(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H16FN3O4/c1-25-12-8-6-11(7-9-12)20-17(24)16(23)19-10-15(22)21-14-5-3-2-4-13(14)18/h2-9H,10H2,1H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | VKTFCKXBRIMPDG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|