C16H18FNO2S — CID 144540679
1-fluoro-2-methylbenzene;N-(4-methoxyphenyl)-2-sulfanylacetamide (PubChem CID 144540679) has the molecular formula C16H18FNO2S and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-fluoro-2-methylbenzene;N-(4-methoxyphenyl)-2-sulfanylacetamide.
| Compound Name | 1-fluoro-2-methylbenzene;N-(4-methoxyphenyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 144540679 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 1-fluoro-2-methylbenzene;N-(4-methoxyphenyl)-2-sulfanylacetamide |
| SMILES | COc1ccc(NC(=O)CS)cc1.Cc1ccccc1F |
| InChI | InChI=1S/C9H11NO2S.C7H7F/c1-12-8-4-2-7(3-5-8)10-9(11)6-13;1-6-4-2-3-5-7(6)8/h2-5,13H,6H2,1H3,(H,10,11);2-5H,1H3 |
| InChIKey | QZXNRSRUUNXINH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|