About ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene
ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene (PubChem CID 156880455) has the molecular formula C18H26F2O
and a molecular weight of 296.40 g/mol. Its IUPAC name is ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene.
Molecular Properties
| Compound Name | ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene |
| PubChem CID | 156880455 |
| Molecular Formula | C18H26F2O |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene |
| SMILES | CC.CC.COc1ccc(F)cc1.Cc1ccccc1F |
| InChI | InChI=1S/C7H7FO.C7H7F.2C2H6/c1-9-7-4-2-6(8)3-5-7;1-6-4-2-3-5-7(6)8;2*1-2/h2-5H,1H3;2-5H,1H3;2*1-2H3 |
| InChIKey | MBBBIMALVVHRJR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene?
The IUPAC name of ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene (CID 156880455) is ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene.
What is the SMILES notation for ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene?
The canonical SMILES for ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene is CC.CC.COc1ccc(F)cc1.Cc1ccccc1F.
What is the InChIKey of ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene?
The InChIKey is MBBBIMALVVHRJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.C7H7F.2C2H6/c1-9-7-4-2-6(8)3-5-7;1-6-4-2-3-5-7(6)8;2*1-2/h2-5H,1H3;2-5H,1H3;2*1-2H3.
What are the key properties of ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene?
ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene has a molecular weight of 296.40 g/mol, XLogP of 6.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-4-methoxybenzene;1-fluoro-2-methylbenzene is sourced from PubChem (CID 156880455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).