About acetylene;1-fluoro-2-methylbenzene
acetylene;1-fluoro-2-methylbenzene (PubChem CID 175248306) has the molecular formula C9H9F
and a molecular weight of 136.17 g/mol. Its IUPAC name is acetylene;1-fluoro-2-methylbenzene.
Molecular Properties
| Compound Name | acetylene;1-fluoro-2-methylbenzene |
| PubChem CID | 175248306 |
| Molecular Formula | C9H9F |
| Molecular Weight | 136.17 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | acetylene;1-fluoro-2-methylbenzene |
| SMILES | C#C.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.C2H2/c1-6-4-2-3-5-7(6)8;1-2/h2-5H,1H3;1-2H |
| InChIKey | SFQACBMIJQYDBA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-fluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-fluoro-2-methylbenzene?
The IUPAC name of acetylene;1-fluoro-2-methylbenzene (CID 175248306) is acetylene;1-fluoro-2-methylbenzene.
What is the SMILES notation for acetylene;1-fluoro-2-methylbenzene?
The canonical SMILES for acetylene;1-fluoro-2-methylbenzene is C#C.Cc1ccccc1F.
What is the InChIKey of acetylene;1-fluoro-2-methylbenzene?
The InChIKey is SFQACBMIJQYDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C2H2/c1-6-4-2-3-5-7(6)8;1-2/h2-5H,1H3;1-2H.
What are the key properties of acetylene;1-fluoro-2-methylbenzene?
acetylene;1-fluoro-2-methylbenzene has a molecular weight of 136.17 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-fluoro-2-methylbenzene is sourced from PubChem (CID 175248306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).