C21H22F2 — CID 160743052
1-fluoro-2-methylbenzene;1-fluoro-3-methylbenzene;toluene (PubChem CID 160743052) has the molecular formula C21H22F2 and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-fluoro-2-methylbenzene;1-fluoro-3-methylbenzene;toluene.
| Compound Name | 1-fluoro-2-methylbenzene;1-fluoro-3-methylbenzene;toluene |
|---|---|
| PubChem CID | 160743052 |
| Molecular Formula | C21H22F2 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-fluoro-2-methylbenzene;1-fluoro-3-methylbenzene;toluene |
| SMILES | Cc1cccc(F)c1.Cc1ccccc1.Cc1ccccc1F |
| InChI | InChI=1S/2C7H7F.C7H8/c1-6-3-2-4-7(8)5-6;1-6-4-2-3-5-7(6)8;1-7-5-3-2-4-6-7/h2*2-5H,1H3;2-6H,1H3 |
| InChIKey | RVVMLVUCVIGHEP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |