About 1-fluoro-2-methylbenzene;formaldehyde
1-fluoro-2-methylbenzene;formaldehyde (PubChem CID 143723361) has the molecular formula C8H9FO
and a molecular weight of 140.16 g/mol. Its IUPAC name is 1-fluoro-2-methylbenzene;formaldehyde.
Molecular Properties
| Compound Name | 1-fluoro-2-methylbenzene;formaldehyde |
| PubChem CID | 143723361 |
| Molecular Formula | C8H9FO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-fluoro-2-methylbenzene;formaldehyde |
| SMILES | C=O.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.CH2O/c1-6-4-2-3-5-7(6)8;1-2/h2-5H,1H3;1H2 |
| InChIKey | AJYVLDLWTGRQCS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-2-methylbenzene;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methylbenzene;formaldehyde?
The IUPAC name of 1-fluoro-2-methylbenzene;formaldehyde (CID 143723361) is 1-fluoro-2-methylbenzene;formaldehyde.
What is the SMILES notation for 1-fluoro-2-methylbenzene;formaldehyde?
The canonical SMILES for 1-fluoro-2-methylbenzene;formaldehyde is C=O.Cc1ccccc1F.
What is the InChIKey of 1-fluoro-2-methylbenzene;formaldehyde?
The InChIKey is AJYVLDLWTGRQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.CH2O/c1-6-4-2-3-5-7(6)8;1-2/h2-5H,1H3;1H2.
What are the key properties of 1-fluoro-2-methylbenzene;formaldehyde?
1-fluoro-2-methylbenzene;formaldehyde has a molecular weight of 140.16 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methylbenzene;formaldehyde is sourced from PubChem (CID 143723361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).