C19H28F2 — CID 142353819
1,3-difluoro-2-methylbenzene;ethane;1,2-xylene (PubChem CID 142353819) has the molecular formula C19H28F2 and a molecular weight of 294.43 g/mol. Its IUPAC name is 1,3-difluoro-2-methylbenzene;ethane;1,2-xylene.
| Compound Name | 1,3-difluoro-2-methylbenzene;ethane;1,2-xylene |
|---|---|
| PubChem CID | 142353819 |
| Molecular Formula | C19H28F2 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1,3-difluoro-2-methylbenzene;ethane;1,2-xylene |
| SMILES | CC.CC.Cc1c(F)cccc1F.Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C7H6F2.2C2H6/c1-7-5-3-4-6-8(7)2;1-5-6(8)3-2-4-7(5)9;2*1-2/h3-6H,1-2H3;2-4H,1H3;2*1-2H3 |
| InChIKey | IBYAVLNEQLPYNC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |