About ethane;1-fluoro-2-methylbenzene;methane
ethane;1-fluoro-2-methylbenzene;methane (PubChem CID 143320188) has the molecular formula C10H17F
and a molecular weight of 156.24 g/mol. Its IUPAC name is ethane;1-fluoro-2-methylbenzene;methane.
Molecular Properties
| Compound Name | ethane;1-fluoro-2-methylbenzene;methane |
| PubChem CID | 143320188 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | ethane;1-fluoro-2-methylbenzene;methane |
| SMILES | C.CC.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.C2H6.CH4/c1-6-4-2-3-5-7(6)8;1-2;/h2-5H,1H3;1-2H3;1H4 |
| InChIKey | UZSXKZAIDOXRAH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-fluoro-2-methylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-2-methylbenzene;methane?
The IUPAC name of ethane;1-fluoro-2-methylbenzene;methane (CID 143320188) is ethane;1-fluoro-2-methylbenzene;methane.
What is the SMILES notation for ethane;1-fluoro-2-methylbenzene;methane?
The canonical SMILES for ethane;1-fluoro-2-methylbenzene;methane is C.CC.Cc1ccccc1F.
What is the InChIKey of ethane;1-fluoro-2-methylbenzene;methane?
The InChIKey is UZSXKZAIDOXRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C2H6.CH4/c1-6-4-2-3-5-7(6)8;1-2;/h2-5H,1H3;1-2H3;1H4.
What are the key properties of ethane;1-fluoro-2-methylbenzene;methane?
ethane;1-fluoro-2-methylbenzene;methane has a molecular weight of 156.24 g/mol, XLogP of 3.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-2-methylbenzene;methane is sourced from PubChem (CID 143320188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).