About ethane;1-fluoro-2-methylbenzene;propane
ethane;1-fluoro-2-methylbenzene;propane (PubChem CID 143588585) has the molecular formula C12H21F
and a molecular weight of 184.30 g/mol. Its IUPAC name is ethane;1-fluoro-2-methylbenzene;propane.
Molecular Properties
| Compound Name | ethane;1-fluoro-2-methylbenzene;propane |
| PubChem CID | 143588585 |
| Molecular Formula | C12H21F |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;1-fluoro-2-methylbenzene;propane |
| SMILES | CC.CCC.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.C3H8.C2H6/c1-6-4-2-3-5-7(6)8;1-3-2;1-2/h2-5H,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | DEBCMKVZROAWRB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-fluoro-2-methylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-2-methylbenzene;propane?
The IUPAC name of ethane;1-fluoro-2-methylbenzene;propane (CID 143588585) is ethane;1-fluoro-2-methylbenzene;propane.
What is the SMILES notation for ethane;1-fluoro-2-methylbenzene;propane?
The canonical SMILES for ethane;1-fluoro-2-methylbenzene;propane is CC.CCC.Cc1ccccc1F.
What is the InChIKey of ethane;1-fluoro-2-methylbenzene;propane?
The InChIKey is DEBCMKVZROAWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C3H8.C2H6/c1-6-4-2-3-5-7(6)8;1-3-2;1-2/h2-5H,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;1-fluoro-2-methylbenzene;propane?
ethane;1-fluoro-2-methylbenzene;propane has a molecular weight of 184.30 g/mol, XLogP of 4.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-2-methylbenzene;propane is sourced from PubChem (CID 143588585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).